C12H10ClF3N4O — CID 102716274
1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylpyrazole-3-carboxamide (PubChem CID 102716274) has the molecular formula C12H10ClF3N4O and a molecular weight of 318.69 g/mol. Its IUPAC name is 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylpyrazole-3-carboxamide.
| Compound Name | 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 102716274 |
| Molecular Formula | C12H10ClF3N4O |
| Molecular Weight | 318.69 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N,N-dimethylpyrazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccn(-c2cc(C(F)(F)F)cc(Cl)n2)n1 |
| InChI | InChI=1S/C12H10ClF3N4O/c1-19(2)11(21)8-3-4-20(18-8)10-6-7(12(14,15)16)5-9(13)17-10/h3-6H,1-2H3 |
| InChIKey | GQXMDCPDICMJMS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.69 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|