C10H13N7O — CID 80904045
1-(6-hydrazinylpyrazin-2-yl)-N,N-dimethylpyrazole-3-carboxamide (PubChem CID 80904045) has the molecular formula C10H13N7O and a molecular weight of 247.26 g/mol. Its IUPAC name is 1-(6-hydrazinylpyrazin-2-yl)-N,N-dimethylpyrazole-3-carboxamide.
| Compound Name | 1-(6-hydrazinylpyrazin-2-yl)-N,N-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 80904045 |
| Molecular Formula | C10H13N7O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1-(6-hydrazinylpyrazin-2-yl)-N,N-dimethylpyrazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccn(-c2cncc(NN)n2)n1 |
| InChI | InChI=1S/C10H13N7O/c1-16(2)10(18)7-3-4-17(15-7)9-6-12-5-8(13-9)14-11/h3-6H,11H2,1-2H3,(H,13,14) |
| InChIKey | OTICUDBRAAYOQQ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|