C13H13ClFN3 — CID 113324856
6-(3-chloro-5-fluorophenyl)-5-ethyl-N-methylpyrimidin-4-amine (PubChem CID 113324856) has the molecular formula C13H13ClFN3 and a molecular weight of 265.72 g/mol. Its IUPAC name is 6-(3-chloro-5-fluorophenyl)-5-ethyl-N-methylpyrimidin-4-amine.
| Compound Name | 6-(3-chloro-5-fluorophenyl)-5-ethyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 113324856 |
| Molecular Formula | C13H13ClFN3 |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 6-(3-chloro-5-fluorophenyl)-5-ethyl-N-methylpyrimidin-4-amine |
| SMILES | CCc1c(NC)ncnc1-c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C13H13ClFN3/c1-3-11-12(17-7-18-13(11)16-2)8-4-9(14)6-10(15)5-8/h4-7H,3H2,1-2H3,(H,16,17,18) |
| InChIKey | XCJSUVNBAWALSF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |