C12H8Cl3FN2 — CID 114453923
4,6-dichloro-2-(3-chloro-5-fluorophenyl)-5-ethylpyrimidine (PubChem CID 114453923) has the molecular formula C12H8Cl3FN2 and a molecular weight of 305.57 g/mol. Its IUPAC name is 4,6-dichloro-2-(3-chloro-5-fluorophenyl)-5-ethylpyrimidine.
| Compound Name | 4,6-dichloro-2-(3-chloro-5-fluorophenyl)-5-ethylpyrimidine |
|---|---|
| PubChem CID | 114453923 |
| Molecular Formula | C12H8Cl3FN2 |
| Molecular Weight | 305.57 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 4,6-dichloro-2-(3-chloro-5-fluorophenyl)-5-ethylpyrimidine |
| SMILES | CCc1c(Cl)nc(-c2cc(F)cc(Cl)c2)nc1Cl |
| InChI | InChI=1S/C12H8Cl3FN2/c1-2-9-10(14)17-12(18-11(9)15)6-3-7(13)5-8(16)4-6/h3-5H,2H2,1H3 |
| InChIKey | BKMAFJXYCZDTQV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |