C13H13BrF3NO — CID 113326042
1-[2-bromo-4-(trifluoromethyl)phenyl]piperidine-3-carbaldehyde (PubChem CID 113326042) has the molecular formula C13H13BrF3NO and a molecular weight of 336.15 g/mol. Its IUPAC name is 1-[2-bromo-4-(trifluoromethyl)phenyl]piperidine-3-carbaldehyde.
| Compound Name | 1-[2-bromo-4-(trifluoromethyl)phenyl]piperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 113326042 |
| Molecular Formula | C13H13BrF3NO |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 1-[2-bromo-4-(trifluoromethyl)phenyl]piperidine-3-carbaldehyde |
| SMILES | O=CC1CCCN(c2ccc(C(F)(F)F)cc2Br)C1 |
| InChI | InChI=1S/C13H13BrF3NO/c14-11-6-10(13(15,16)17)3-4-12(11)18-5-1-2-9(7-18)8-19/h3-4,6,8-9H,1-2,5,7H2 |
| InChIKey | IXWVBFWGUWTTHN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|