C13H14Br2F3N — CID 114062558
1-[2-bromo-4-(bromomethyl)phenyl]-3-(trifluoromethyl)piperidine (PubChem CID 114062558) has the molecular formula C13H14Br2F3N and a molecular weight of 401.06 g/mol. Its IUPAC name is 1-[2-bromo-4-(bromomethyl)phenyl]-3-(trifluoromethyl)piperidine.
| Compound Name | 1-[2-bromo-4-(bromomethyl)phenyl]-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 114062558 |
| Molecular Formula | C13H14Br2F3N |
| Molecular Weight | 401.06 g/mol |
| Exact Mass | 398.94 |
| IUPAC Name | 1-[2-bromo-4-(bromomethyl)phenyl]-3-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)C1CCCN(c2ccc(CBr)cc2Br)C1 |
| InChI | InChI=1S/C13H14Br2F3N/c14-7-9-3-4-12(11(15)6-9)19-5-1-2-10(8-19)13(16,17)18/h3-4,6,10H,1-2,5,7-8H2 |
| InChIKey | LTYCNRWLEZAFMI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.06 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|