C18H25F3N2 — CID 169488631
5-cyclohexyl-2-[3-(trifluoromethyl)piperidin-1-yl]aniline (PubChem CID 169488631) has the molecular formula C18H25F3N2 and a molecular weight of 326.41 g/mol. Its IUPAC name is 5-cyclohexyl-2-[3-(trifluoromethyl)piperidin-1-yl]aniline.
| Compound Name | 5-cyclohexyl-2-[3-(trifluoromethyl)piperidin-1-yl]aniline |
|---|---|
| PubChem CID | 169488631 |
| Molecular Formula | C18H25F3N2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 5-cyclohexyl-2-[3-(trifluoromethyl)piperidin-1-yl]aniline |
| SMILES | Nc1cc(C2CCCCC2)ccc1N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C18H25F3N2/c19-18(20,21)15-7-4-10-23(12-15)17-9-8-14(11-16(17)22)13-5-2-1-3-6-13/h8-9,11,13,15H,1-7,10,12,22H2 |
| InChIKey | BMYRULAGEOXQDL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|