C11H15F3N4 — CID 79825633
6-[3-(trifluoromethyl)piperidin-1-yl]pyridine-2,3-diamine (PubChem CID 79825633) has the molecular formula C11H15F3N4 and a molecular weight of 260.26 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)piperidin-1-yl]pyridine-2,3-diamine.
| Compound Name | 6-[3-(trifluoromethyl)piperidin-1-yl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 79825633 |
| Molecular Formula | C11H15F3N4 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 6-[3-(trifluoromethyl)piperidin-1-yl]pyridine-2,3-diamine |
| SMILES | Nc1ccc(N2CCCC(C(F)(F)F)C2)nc1N |
| InChI | InChI=1S/C11H15F3N4/c12-11(13,14)7-2-1-5-18(6-7)9-4-3-8(15)10(16)17-9/h3-4,7H,1-2,5-6,15H2,(H2,16,17) |
| InChIKey | WGUVOJJWCSEFGL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |