C16H19F3N4 — CID 144746669
5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5,9(13)-tetraene (PubChem CID 144746669) has the molecular formula C16H19F3N4 and a molecular weight of 324.35 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5,9(13)-tetraene.
| Compound Name | 5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5,9(13)-tetraene |
|---|---|
| PubChem CID | 144746669 |
| Molecular Formula | C16H19F3N4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 5-[3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5,9(13)-tetraene |
| SMILES | FC(F)(F)C1CCCN(c2ccc3c(n2)NC2=CN3CCC2)C1 |
| InChI | InChI=1S/C16H19F3N4/c17-16(18,19)11-3-1-8-23(9-11)14-6-5-13-15(21-14)20-12-4-2-7-22(13)10-12/h5-6,10-11H,1-4,7-9H2,(H,20,21) |
| InChIKey | DJIGVMUXLYVSRT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |