C16H23Br2N — CID 114062528
1-[2-bromo-4-(bromomethyl)phenyl]-4-tert-butylpiperidine (PubChem CID 114062528) has the molecular formula C16H23Br2N and a molecular weight of 389.18 g/mol. Its IUPAC name is 1-[2-bromo-4-(bromomethyl)phenyl]-4-tert-butylpiperidine.
| Compound Name | 1-[2-bromo-4-(bromomethyl)phenyl]-4-tert-butylpiperidine |
|---|---|
| PubChem CID | 114062528 |
| Molecular Formula | C16H23Br2N |
| Molecular Weight | 389.18 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 1-[2-bromo-4-(bromomethyl)phenyl]-4-tert-butylpiperidine |
| SMILES | CC(C)(C)C1CCN(c2ccc(CBr)cc2Br)CC1 |
| InChI | InChI=1S/C16H23Br2N/c1-16(2,3)13-6-8-19(9-7-13)15-5-4-12(11-17)10-14(15)18/h4-5,10,13H,6-9,11H2,1-3H3 |
| InChIKey | GHMIWISWJGJPFG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.18 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|