C15H23BrN2 — CID 114062756
1-[3-bromo-4-(4-ethylpiperidin-1-yl)phenyl]-N-methylmethanamine (PubChem CID 114062756) has the molecular formula C15H23BrN2 and a molecular weight of 311.27 g/mol. Its IUPAC name is 1-[3-bromo-4-(4-ethylpiperidin-1-yl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3-bromo-4-(4-ethylpiperidin-1-yl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114062756 |
| Molecular Formula | C15H23BrN2 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-[3-bromo-4-(4-ethylpiperidin-1-yl)phenyl]-N-methylmethanamine |
| SMILES | CCC1CCN(c2ccc(CNC)cc2Br)CC1 |
| InChI | InChI=1S/C15H23BrN2/c1-3-12-6-8-18(9-7-12)15-5-4-13(11-17-2)10-14(15)16/h4-5,10,12,17H,3,6-9,11H2,1-2H3 |
| InChIKey | URQJOLBEAIKJCK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|