C13H18BrNOS — CID 114237375
[3-bromo-4-(4-methylsulfanylpiperidin-1-yl)phenyl]methanol (PubChem CID 114237375) has the molecular formula C13H18BrNOS and a molecular weight of 316.26 g/mol. Its IUPAC name is [3-bromo-4-(4-methylsulfanylpiperidin-1-yl)phenyl]methanol.
| Compound Name | [3-bromo-4-(4-methylsulfanylpiperidin-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 114237375 |
| Molecular Formula | C13H18BrNOS |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | [3-bromo-4-(4-methylsulfanylpiperidin-1-yl)phenyl]methanol |
| SMILES | CSC1CCN(c2ccc(CO)cc2Br)CC1 |
| InChI | InChI=1S/C13H18BrNOS/c1-17-11-4-6-15(7-5-11)13-3-2-10(9-16)8-12(13)14/h2-3,8,11,16H,4-7,9H2,1H3 |
| InChIKey | WKIGKFUSUHCCRV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|