C12H20F3NO2 — CID 113326572
3-[1-(4,4,4-trifluorobutyl)piperidin-2-yl]propanoic acid (PubChem CID 113326572) has the molecular formula C12H20F3NO2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-[1-(4,4,4-trifluorobutyl)piperidin-2-yl]propanoic acid.
| Compound Name | 3-[1-(4,4,4-trifluorobutyl)piperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 113326572 |
| Molecular Formula | C12H20F3NO2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-[1-(4,4,4-trifluorobutyl)piperidin-2-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCCCN1CCCC(F)(F)F |
| InChI | InChI=1S/C12H20F3NO2/c13-12(14,15)7-3-9-16-8-2-1-4-10(16)5-6-11(17)18/h10H,1-9H2,(H,17,18) |
| InChIKey | XNHMZUJHCCSLGL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |