3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid

C13H25NO2 — CID 119994332

IUPAC3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid
SMILESCC(C)CCC1CCCCN1CCC(=O)O
InChIInChI=1S/C13H25NO2/c1-11(2)6-7-12-5-3-4-9-14(12)10-8-13(15)16/h11-12H,3-10H2,1-2H3,(H,15,16)
InChIKeyUSELBPAVWWUFEE-UHFFFAOYSA-N
MW227.35 g/mol
LogP2.75
Rot. Bonds6

About 3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid

3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid (PubChem CID 119994332) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid
PubChem CID119994332
Molecular FormulaC13H25NO2
Molecular Weight227.35 g/mol
Exact Mass227.19
IUPAC Name3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid
SMILESCC(C)CCC1CCCCN1CCC(=O)O
InChIInChI=1S/C13H25NO2/c1-11(2)6-7-12-5-3-4-9-14(12)10-8-13(15)16/h11-12H,3-10H2,1-2H3,(H,15,16)
InChIKeyUSELBPAVWWUFEE-UHFFFAOYSA-N
XLogP2.75
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.35
LogP ≤ 52.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[2-(2-methylpropyl)azepan-1-yl]propanoic acid
CID 119137915
3-[(2R)-2-(2-hydroxyethyl)piperidin-1-yl]propanoic acid
CID 29295033
3-[(2S)-2-(hydroxymethyl)piperidin-1-yl]propanoic acid
CID 94161350
3-[(2R)-2-(ethoxymethyl)piperidin-1-yl]propanoic acid
CID 129323089
3-[1-[4-(dimethylamino)-4-oxobutyl]piperidin-2-yl]propanoic acid
CID 62216161
2-(2-chloroethyl)-1-(4-methylpentyl)piperidine
CID 83169323
3-[(2R)-2-benzylpiperidin-1-yl]propanoic acid
CID 97214231
3-[1-(2-tert-butylsulfonylethyl)piperidin-2-yl]propanoic acid
CID 106727487
3-[1-(3-methylbut-2-enyl)piperidin-2-yl]propanoic acid
CID 62218206
3-[2-(2-hydroxy-2-phenylethyl)azepan-1-yl]propanoic acid;hydrochloride
CID 119934761
4-amino-1-[2-(3-methylbutyl)piperidin-1-yl]pentan-1-one
CID 120564107
3-[1-(4,4,4-trifluorobutyl)piperidin-2-yl]propanoic acid
CID 113326572

Frequently Asked Questions

What is the IUPAC name of 3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid?
The IUPAC name of 3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid (CID 119994332) is 3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid.
What is the SMILES notation for 3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid?
The canonical SMILES for 3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid is CC(C)CCC1CCCCN1CCC(=O)O.
What is the InChIKey of 3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid?
The InChIKey is USELBPAVWWUFEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-11(2)6-7-12-5-3-4-9-14(12)10-8-13(15)16/h11-12H,3-10H2,1-2H3,(H,15,16).
What are the key properties of 3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid?
3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid has a molecular weight of 227.35 g/mol, XLogP of 2.75, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-methylbutyl)piperidin-1-yl]propanoic acid is sourced from PubChem (CID 119994332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).