C8H13F3N4O2S — CID 113326670
5-amino-3-methyl-N-(4,4,4-trifluorobutyl)imidazole-4-sulfonamide (PubChem CID 113326670) has the molecular formula C8H13F3N4O2S and a molecular weight of 286.28 g/mol. Its IUPAC name is 5-amino-3-methyl-N-(4,4,4-trifluorobutyl)imidazole-4-sulfonamide.
| Compound Name | 5-amino-3-methyl-N-(4,4,4-trifluorobutyl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 113326670 |
| Molecular Formula | C8H13F3N4O2S |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 5-amino-3-methyl-N-(4,4,4-trifluorobutyl)imidazole-4-sulfonamide |
| SMILES | Cn1cnc(N)c1S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C8H13F3N4O2S/c1-15-5-13-6(12)7(15)18(16,17)14-4-2-3-8(9,10)11/h5,14H,2-4,12H2,1H3 |
| InChIKey | QSLCSSKCLVFLAL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|