C11H13F3N4 — CID 113326752
5-amino-2-(5,5,5-trifluoropentylamino)pyridine-3-carbonitrile (PubChem CID 113326752) has the molecular formula C11H13F3N4 and a molecular weight of 258.25 g/mol. Its IUPAC name is 5-amino-2-(5,5,5-trifluoropentylamino)pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-(5,5,5-trifluoropentylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 113326752 |
| Molecular Formula | C11H13F3N4 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 5-amino-2-(5,5,5-trifluoropentylamino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(N)cnc1NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H13F3N4/c12-11(13,14)3-1-2-4-17-10-8(6-15)5-9(16)7-18-10/h5,7H,1-4,16H2,(H,17,18) |
| InChIKey | HSYQLCGKHNZBTN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|