C12H22F3NO — CID 113326769
1-ethyl-4-(4,4,4-trifluorobutyl)azepan-4-ol (PubChem CID 113326769) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is 1-ethyl-4-(4,4,4-trifluorobutyl)azepan-4-ol.
| Compound Name | 1-ethyl-4-(4,4,4-trifluorobutyl)azepan-4-ol |
|---|---|
| PubChem CID | 113326769 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-ethyl-4-(4,4,4-trifluorobutyl)azepan-4-ol |
| SMILES | CCN1CCCC(O)(CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3NO/c1-2-16-9-4-6-11(17,8-10-16)5-3-7-12(13,14)15/h17H,2-10H2,1H3 |
| InChIKey | WQHUUYKJAZNGBA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |