C12H18F3NO2 — CID 113326855
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5,5,5-trifluoropentan-1-one (PubChem CID 113326855) has the molecular formula C12H18F3NO2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 113326855 |
| Molecular Formula | C12H18F3NO2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5,5,5-trifluoropentan-1-one |
| SMILES | O=C(CCCC(F)(F)F)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C12H18F3NO2/c13-12(14,15)5-1-4-10(17)11-7-16-6-2-3-9(16)8-18-11/h9,11H,1-8H2 |
| InChIKey | VGHPKBKDSZPIBE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |