C16H26F3N3O2 — CID 129378501
3-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-cyclobutyl-1-(3,3,3-trifluoropropyl)urea (PubChem CID 129378501) has the molecular formula C16H26F3N3O2 and a molecular weight of 349.40 g/mol. Its IUPAC name is 3-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-cyclobutyl-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-cyclobutyl-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 129378501 |
| Molecular Formula | C16H26F3N3O2 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 3-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-cyclobutyl-1-(3,3,3-trifluoropropyl)urea |
| SMILES | O=C(NC[C@H]1CN2CCC[C@H]2CO1)N(CCC(F)(F)F)C1CCC1 |
| InChI | InChI=1S/C16H26F3N3O2/c17-16(18,19)6-8-22(12-3-1-4-12)15(23)20-9-14-10-21-7-2-5-13(21)11-24-14/h12-14H,1-11H2,(H,20,23)/t13-,14-/m0/s1 |
| InChIKey | GGXYGBCAIBIQKQ-KBPBESRZSA-N |
| XLogP | 2.37 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |