About 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane
4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane (PubChem CID 113327230) has the molecular formula C8H18F3N3O2S
and a molecular weight of 277.31 g/mol. Its IUPAC name is 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane.
Molecular Properties
| Compound Name | 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane |
| PubChem CID | 113327230 |
| Molecular Formula | C8H18F3N3O2S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane |
| SMILES | CN(CCCN)S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C8H18F3N3O2S/c1-14(7-3-5-12)17(15,16)13-6-2-4-8(9,10)11/h13H,2-7,12H2,1H3 |
| InChIKey | IKTTVERTLWZSQL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane?
The IUPAC name of 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane (CID 113327230) is 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane.
What is the SMILES notation for 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane?
The canonical SMILES for 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane is CN(CCCN)S(=O)(=O)NCCCC(F)(F)F.
What is the InChIKey of 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane?
The InChIKey is IKTTVERTLWZSQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18F3N3O2S/c1-14(7-3-5-12)17(15,16)13-6-2-4-8(9,10)11/h13H,2-7,12H2,1H3.
What are the key properties of 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane?
4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane has a molecular weight of 277.31 g/mol, XLogP of 0.44, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-aminopropyl(methyl)sulfamoyl]amino]-1,1,1-trifluorobutane is sourced from PubChem (CID 113327230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).