C12H22F3NO — CID 113327558
(Z)-8,8,8-trifluoro-N-(2-methoxyethyl)-4-methyloct-3-en-1-amine (PubChem CID 113327558) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is (Z)-8,8,8-trifluoro-N-(2-methoxyethyl)-4-methyloct-3-en-1-amine.
| Compound Name | (Z)-8,8,8-trifluoro-N-(2-methoxyethyl)-4-methyloct-3-en-1-amine |
|---|---|
| PubChem CID | 113327558 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (Z)-8,8,8-trifluoro-N-(2-methoxyethyl)-4-methyloct-3-en-1-amine |
| SMILES | COCCNCC/C=C(/C)CCCC(F)(F)F |
| InChI | InChI=1S/C12H22F3NO/c1-11(5-3-7-12(13,14)15)6-4-8-16-9-10-17-2/h6,16H,3-5,7-10H2,1-2H3/b11-6- |
| InChIKey | TUYWHIGJGHUEBN-WDZFZDKYSA-N |
| XLogP | 3.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|