About 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine
9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine (PubChem CID 113328116) has the molecular formula C13H23F3N2
and a molecular weight of 264.33 g/mol. Its IUPAC name is 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine.
Molecular Properties
| Compound Name | 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine |
| PubChem CID | 113328116 |
| Molecular Formula | C13H23F3N2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine |
| SMILES | NC1CC2CCCC(C1)N2CCCCC(F)(F)F |
| InChI | InChI=1S/C13H23F3N2/c14-13(15,16)6-1-2-7-18-11-4-3-5-12(18)9-10(17)8-11/h10-12H,1-9,17H2 |
| InChIKey | MZHLBWHUPYBFRA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine?
The IUPAC name of 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine (CID 113328116) is 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine.
What is the SMILES notation for 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine?
The canonical SMILES for 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine is NC1CC2CCCC(C1)N2CCCCC(F)(F)F.
What is the InChIKey of 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine?
The InChIKey is MZHLBWHUPYBFRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F3N2/c14-13(15,16)6-1-2-7-18-11-4-3-5-12(18)9-10(17)8-11/h10-12H,1-9,17H2.
What are the key properties of 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine?
9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine has a molecular weight of 264.33 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(5,5,5-trifluoropentyl)-9-azabicyclo[3.3.1]nonan-3-amine is sourced from PubChem (CID 113328116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).