C11H12F2N4 — CID 113328558
4-[4-(difluoromethyl)phenyl]-2-methylimidazole-1,5-diamine (PubChem CID 113328558) has the molecular formula C11H12F2N4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 4-[4-(difluoromethyl)phenyl]-2-methylimidazole-1,5-diamine.
| Compound Name | 4-[4-(difluoromethyl)phenyl]-2-methylimidazole-1,5-diamine |
|---|---|
| PubChem CID | 113328558 |
| Molecular Formula | C11H12F2N4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 4-[4-(difluoromethyl)phenyl]-2-methylimidazole-1,5-diamine |
| SMILES | Cc1nc(-c2ccc(C(F)F)cc2)c(N)n1N |
| InChI | InChI=1S/C11H12F2N4/c1-6-16-9(11(14)17(6)15)7-2-4-8(5-3-7)10(12)13/h2-5,10H,14-15H2,1H3 |
| InChIKey | OFMIFHLXPSYYGK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |