C12H10F2IN3 — CID 113328565
2-[4-(difluoromethyl)phenyl]-5-iodo-6-methylpyrimidin-4-amine (PubChem CID 113328565) has the molecular formula C12H10F2IN3 and a molecular weight of 361.13 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)phenyl]-5-iodo-6-methylpyrimidin-4-amine.
| Compound Name | 2-[4-(difluoromethyl)phenyl]-5-iodo-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 113328565 |
| Molecular Formula | C12H10F2IN3 |
| Molecular Weight | 361.13 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2-[4-(difluoromethyl)phenyl]-5-iodo-6-methylpyrimidin-4-amine |
| SMILES | Cc1nc(-c2ccc(C(F)F)cc2)nc(N)c1I |
| InChI | InChI=1S/C12H10F2IN3/c1-6-9(15)11(16)18-12(17-6)8-4-2-7(3-5-8)10(13)14/h2-5,10H,1H3,(H2,16,17,18) |
| InChIKey | LAJLDGAQXAUPFA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.13 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|