C15H15F2NO — CID 113330087
N-(cyclopropylmethyl)-2-(2,6-difluorophenyl)-N-prop-2-ynylacetamide (PubChem CID 113330087) has the molecular formula C15H15F2NO and a molecular weight of 263.29 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(2,6-difluorophenyl)-N-prop-2-ynylacetamide.
| Compound Name | N-(cyclopropylmethyl)-2-(2,6-difluorophenyl)-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 113330087 |
| Molecular Formula | C15H15F2NO |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(2,6-difluorophenyl)-N-prop-2-ynylacetamide |
| SMILES | C#CCN(CC1CC1)C(=O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C15H15F2NO/c1-2-8-18(10-11-6-7-11)15(19)9-12-13(16)4-3-5-14(12)17/h1,3-5,11H,6-10H2 |
| InChIKey | RXNRDLMHTZIWHG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|