C16H22ClFN2O — CID 79698350
2-(2-chloro-6-fluorophenyl)-N-ethyl-N-(piperidin-4-ylmethyl)acetamide (PubChem CID 79698350) has the molecular formula C16H22ClFN2O and a molecular weight of 312.82 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-ethyl-N-(piperidin-4-ylmethyl)acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-ethyl-N-(piperidin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 79698350 |
| Molecular Formula | C16H22ClFN2O |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-ethyl-N-(piperidin-4-ylmethyl)acetamide |
| SMILES | CCN(CC1CCNCC1)C(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H22ClFN2O/c1-2-20(11-12-6-8-19-9-7-12)16(21)10-13-14(17)4-3-5-15(13)18/h3-5,12,19H,2,6-11H2,1H3 |
| InChIKey | YPSOBGFRUZAHQE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |