C11H7BrF2N2O2 — CID 113330185
N-(4-bromo-2,5-difluorophenyl)-4-methyl-1,3-oxazole-5-carboxamide (PubChem CID 113330185) has the molecular formula C11H7BrF2N2O2 and a molecular weight of 317.09 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-4-methyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-4-methyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 113330185 |
| Molecular Formula | C11H7BrF2N2O2 |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-4-methyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1ncoc1C(=O)Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C11H7BrF2N2O2/c1-5-10(18-4-15-5)11(17)16-9-3-7(13)6(12)2-8(9)14/h2-4H,1H3,(H,16,17) |
| InChIKey | JMHMUFHFFUBLBM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|