C21H22N2O3 — CID 113330854
ethyl 2-[benzyl-[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]acetate (PubChem CID 113330854) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 2-[benzyl-[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]acetate.
| Compound Name | ethyl 2-[benzyl-[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]acetate |
|---|---|
| PubChem CID | 113330854 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | ethyl 2-[benzyl-[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccc1)Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C21H22N2O3/c1-2-25-21(24)16-23(14-17-9-5-3-6-10-17)15-19-13-20(26-22-19)18-11-7-4-8-12-18/h3-13H,2,14-16H2,1H3 |
| InChIKey | YFFFBNZTNXBSJH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |