C15H20N2O2 — CID 60693417
2-[(5-phenyl-1,2-oxazol-3-yl)methyl-propylamino]ethanol (PubChem CID 60693417) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[(5-phenyl-1,2-oxazol-3-yl)methyl-propylamino]ethanol.
| Compound Name | 2-[(5-phenyl-1,2-oxazol-3-yl)methyl-propylamino]ethanol |
|---|---|
| PubChem CID | 60693417 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-[(5-phenyl-1,2-oxazol-3-yl)methyl-propylamino]ethanol |
| SMILES | CCCN(CCO)Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C15H20N2O2/c1-2-8-17(9-10-18)12-14-11-15(19-16-14)13-6-4-3-5-7-13/h3-7,11,18H,2,8-10,12H2,1H3 |
| InChIKey | DGUNAUOKZQWPQO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |