C16H20N2O3 — CID 62825872
3-[ethyl-[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid (PubChem CID 62825872) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[ethyl-[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid.
| Compound Name | 3-[ethyl-[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 62825872 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-[ethyl-[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid |
| SMILES | CCN(Cc1cc(-c2ccccc2)on1)C(C)CC(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-3-18(12(2)9-16(19)20)11-14-10-15(21-17-14)13-7-5-4-6-8-13/h4-8,10,12H,3,9,11H2,1-2H3,(H,19,20) |
| InChIKey | UPTKGISJKMWHHB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |