About 3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid
3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid (PubChem CID 62828358) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid.
Analyze 3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid?
The IUPAC name of 3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid (CID 62828358) is 3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid.
What is the SMILES notation for 3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid?
The canonical SMILES for 3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid is CCN(Cc1cc(C)on1)C(C)CC(=O)O.
What is the InChIKey of 3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid?
The InChIKey is UDSOTAVQCBVNOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-4-13(8(2)5-11(14)15)7-10-6-9(3)16-12-10/h6,8H,4-5,7H2,1-3H3,(H,14,15).
What are the key properties of 3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid?
3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid has a molecular weight of 226.28 g/mol, XLogP of 1.67, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]butanoic acid is sourced from PubChem (CID 62828358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).