C9H15N3O3 — CID 62825864
3-[ethyl(1,2,4-oxadiazol-3-ylmethyl)amino]butanoic acid (PubChem CID 62825864) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-[ethyl(1,2,4-oxadiazol-3-ylmethyl)amino]butanoic acid.
| Compound Name | 3-[ethyl(1,2,4-oxadiazol-3-ylmethyl)amino]butanoic acid |
|---|---|
| PubChem CID | 62825864 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 3-[ethyl(1,2,4-oxadiazol-3-ylmethyl)amino]butanoic acid |
| SMILES | CCN(Cc1ncon1)C(C)CC(=O)O |
| InChI | InChI=1S/C9H15N3O3/c1-3-12(7(2)4-9(13)14)5-8-10-6-15-11-8/h6-7H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | JSNKUBQKWYBHMY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |