C13H21N3O2 — CID 113330911
methyl 1-[2-(2-methylimidazol-1-yl)ethyl]piperidine-2-carboxylate (PubChem CID 113330911) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is methyl 1-[2-(2-methylimidazol-1-yl)ethyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[2-(2-methylimidazol-1-yl)ethyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 113330911 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | methyl 1-[2-(2-methylimidazol-1-yl)ethyl]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1CCn1ccnc1C |
| InChI | InChI=1S/C13H21N3O2/c1-11-14-6-8-15(11)9-10-16-7-4-3-5-12(16)13(17)18-2/h6,8,12H,3-5,7,9-10H2,1-2H3 |
| InChIKey | MBBLPQKCXRMKQR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |