C12H19N3O2 — CID 115536883
methyl 1-(2-imidazol-1-ylethyl)piperidine-2-carboxylate (PubChem CID 115536883) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 1-(2-imidazol-1-ylethyl)piperidine-2-carboxylate.
| Compound Name | methyl 1-(2-imidazol-1-ylethyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115536883 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | methyl 1-(2-imidazol-1-ylethyl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1CCn1ccnc1 |
| InChI | InChI=1S/C12H19N3O2/c1-17-12(16)11-4-2-3-6-15(11)9-8-14-7-5-13-10-14/h5,7,10-11H,2-4,6,8-9H2,1H3 |
| InChIKey | PDKCLRUWOLRIKJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |