C14H19N3S — CID 113333998
7-methyl-1-[(2-methylthiolan-2-yl)methyl]benzimidazol-2-amine (PubChem CID 113333998) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 7-methyl-1-[(2-methylthiolan-2-yl)methyl]benzimidazol-2-amine.
| Compound Name | 7-methyl-1-[(2-methylthiolan-2-yl)methyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 113333998 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 7-methyl-1-[(2-methylthiolan-2-yl)methyl]benzimidazol-2-amine |
| SMILES | Cc1cccc2nc(N)n(CC3(C)CCCS3)c12 |
| InChI | InChI=1S/C14H19N3S/c1-10-5-3-6-11-12(10)17(13(15)16-11)9-14(2)7-4-8-18-14/h3,5-6H,4,7-9H2,1-2H3,(H2,15,16) |
| InChIKey | QTDOQNVHRCMQMX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |