C15H21ClN2 — CID 113334040
2-(chloromethyl)-7-methyl-1-(2-methylpentan-3-yl)benzimidazole (PubChem CID 113334040) has the molecular formula C15H21ClN2 and a molecular weight of 264.80 g/mol. Its IUPAC name is 2-(chloromethyl)-7-methyl-1-(2-methylpentan-3-yl)benzimidazole.
| Compound Name | 2-(chloromethyl)-7-methyl-1-(2-methylpentan-3-yl)benzimidazole |
|---|---|
| PubChem CID | 113334040 |
| Molecular Formula | C15H21ClN2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-(chloromethyl)-7-methyl-1-(2-methylpentan-3-yl)benzimidazole |
| SMILES | CCC(C(C)C)n1c(CCl)nc2cccc(C)c21 |
| InChI | InChI=1S/C15H21ClN2/c1-5-13(10(2)3)18-14(9-16)17-12-8-6-7-11(4)15(12)18/h6-8,10,13H,5,9H2,1-4H3 |
| InChIKey | BYZKIZCDMCZPJM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|