C16H23ClN2 — CID 115553382
2-(2-chloroethyl)-1-hexan-2-yl-7-methylbenzimidazole (PubChem CID 115553382) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-hexan-2-yl-7-methylbenzimidazole.
| Compound Name | 2-(2-chloroethyl)-1-hexan-2-yl-7-methylbenzimidazole |
|---|---|
| PubChem CID | 115553382 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-(2-chloroethyl)-1-hexan-2-yl-7-methylbenzimidazole |
| SMILES | CCCCC(C)n1c(CCCl)nc2cccc(C)c21 |
| InChI | InChI=1S/C16H23ClN2/c1-4-5-8-13(3)19-15(10-11-17)18-14-9-6-7-12(2)16(14)19/h6-7,9,13H,4-5,8,10-11H2,1-3H3 |
| InChIKey | MWSFDPHGOCZVSV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|