C12H12BrN3O2S — CID 113335287
1-(4-bromo-3-nitrophenyl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)methanamine (PubChem CID 113335287) has the molecular formula C12H12BrN3O2S and a molecular weight of 342.22 g/mol. Its IUPAC name is 1-(4-bromo-3-nitrophenyl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)methanamine.
| Compound Name | 1-(4-bromo-3-nitrophenyl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)methanamine |
|---|---|
| PubChem CID | 113335287 |
| Molecular Formula | C12H12BrN3O2S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 1-(4-bromo-3-nitrophenyl)-N-methyl-N-(1,3-thiazol-4-ylmethyl)methanamine |
| SMILES | CN(Cc1ccc(Br)c([N+](=O)[O-])c1)Cc1cscn1 |
| InChI | InChI=1S/C12H12BrN3O2S/c1-15(6-10-7-19-8-14-10)5-9-2-3-11(13)12(4-9)16(17)18/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | RTQKBQGJEFSTEZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|