C17H16ClN5O2S — CID 133309856
3-chloro-N-[3-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]phenyl]-5-nitropyridin-2-amine (PubChem CID 133309856) has the molecular formula C17H16ClN5O2S and a molecular weight of 389.87 g/mol. Its IUPAC name is 3-chloro-N-[3-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]phenyl]-5-nitropyridin-2-amine.
| Compound Name | 3-chloro-N-[3-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]phenyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133309856 |
| Molecular Formula | C17H16ClN5O2S |
| Molecular Weight | 389.87 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 3-chloro-N-[3-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]phenyl]-5-nitropyridin-2-amine |
| SMILES | CN(Cc1cccc(Nc2ncc([N+](=O)[O-])cc2Cl)c1)Cc1cscn1 |
| InChI | InChI=1S/C17H16ClN5O2S/c1-22(9-14-10-26-11-20-14)8-12-3-2-4-13(5-12)21-17-16(18)6-15(7-19-17)23(24)25/h2-7,10-11H,8-9H2,1H3,(H,19,21) |
| InChIKey | FMMWOARLVQUNKM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|