C10H13F4NO2 — CID 113341284
N-(2-cyclopropyloxolan-3-yl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 113341284) has the molecular formula C10H13F4NO2 and a molecular weight of 255.21 g/mol. Its IUPAC name is N-(2-cyclopropyloxolan-3-yl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(2-cyclopropyloxolan-3-yl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 113341284 |
| Molecular Formula | C10H13F4NO2 |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(2-cyclopropyloxolan-3-yl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(NC1CCOC1C1CC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H13F4NO2/c11-8(12)10(13,14)9(16)15-6-3-4-17-7(6)5-1-2-5/h5-8H,1-4H2,(H,15,16) |
| InChIKey | UWMABUXTUPXUDX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|