C14H16BrClN2O — CID 113343618
2-[(4-bromo-2-chlorophenyl)methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 113343618) has the molecular formula C14H16BrClN2O and a molecular weight of 343.65 g/mol. Its IUPAC name is 2-[(4-bromo-2-chlorophenyl)methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-[(4-bromo-2-chlorophenyl)methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 113343618 |
| Molecular Formula | C14H16BrClN2O |
| Molecular Weight | 343.65 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2-[(4-bromo-2-chlorophenyl)methyl]-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C1CCC2CN(Cc3ccc(Br)cc3Cl)CCN12 |
| InChI | InChI=1S/C14H16BrClN2O/c15-11-2-1-10(13(16)7-11)8-17-5-6-18-12(9-17)3-4-14(18)19/h1-2,7,12H,3-6,8-9H2 |
| InChIKey | JFYZFRALYZFYPY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |