C12H15BrClN — CID 115602343
1-[(4-bromo-2-chlorophenyl)methyl]-3-methylpyrrolidine (PubChem CID 115602343) has the molecular formula C12H15BrClN and a molecular weight of 288.62 g/mol. Its IUPAC name is 1-[(4-bromo-2-chlorophenyl)methyl]-3-methylpyrrolidine.
| Compound Name | 1-[(4-bromo-2-chlorophenyl)methyl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 115602343 |
| Molecular Formula | C12H15BrClN |
| Molecular Weight | 288.62 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 1-[(4-bromo-2-chlorophenyl)methyl]-3-methylpyrrolidine |
| SMILES | CC1CCN(Cc2ccc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C12H15BrClN/c1-9-4-5-15(7-9)8-10-2-3-11(13)6-12(10)14/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | MJBVDXCTRJMGAY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |