C21H33BFNO2 — CID 113345825
1-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-propylpiperidine (PubChem CID 113345825) has the molecular formula C21H33BFNO2 and a molecular weight of 361.31 g/mol. Its IUPAC name is 1-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-propylpiperidine.
| Compound Name | 1-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-propylpiperidine |
|---|---|
| PubChem CID | 113345825 |
| Molecular Formula | C21H33BFNO2 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 1-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-propylpiperidine |
| SMILES | CCCC1CCCCN1Cc1ccc(F)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C21H33BFNO2/c1-6-9-17-10-7-8-13-24(17)15-16-11-12-19(23)18(14-16)22-25-20(2,3)21(4,5)26-22/h11-12,14,17H,6-10,13,15H2,1-5H3 |
| InChIKey | OLTGBSJOMFIGKT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|