C16H14N2O2 — CID 11334618
3-(2-amino-5-methyl-3-pyridinyl)-1-(4-methoxyphenyl)prop-2-yn-1-one (PubChem CID 11334618) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-(2-amino-5-methyl-3-pyridinyl)-1-(4-methoxyphenyl)prop-2-yn-1-one.
| Compound Name | 3-(2-amino-5-methyl-3-pyridinyl)-1-(4-methoxyphenyl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 11334618 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-(2-amino-5-methyl-3-pyridinyl)-1-(4-methoxyphenyl)prop-2-yn-1-one |
| SMILES | COc1ccc(C(=O)C#Cc2cc(C)cnc2N)cc1 |
| InChI | InChI=1S/C16H14N2O2/c1-11-9-13(16(17)18-10-11)5-8-15(19)12-3-6-14(20-2)7-4-12/h3-4,6-7,9-10H,1-2H3,(H2,17,18) |
| InChIKey | VTNXEDIPHKTBBJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|