C18H16O2 — CID 167435432
1-(3,5-dimethylphenyl)-3-(4-methoxyphenyl)prop-2-yn-1-one (PubChem CID 167435432) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(4-methoxyphenyl)prop-2-yn-1-one.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(4-methoxyphenyl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 167435432 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(4-methoxyphenyl)prop-2-yn-1-one |
| SMILES | COc1ccc(C#CC(=O)c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C18H16O2/c1-13-10-14(2)12-16(11-13)18(19)9-6-15-4-7-17(20-3)8-5-15/h4-5,7-8,10-12H,1-3H3 |
| InChIKey | AEZKCRWVZBNZJH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|