C13H23NOS2 — CID 113348811
2-methyl-N-(4-methylsulfinylbutan-2-yl)-1-thiophen-2-ylpropan-1-amine (PubChem CID 113348811) has the molecular formula C13H23NOS2 and a molecular weight of 273.47 g/mol. Its IUPAC name is 2-methyl-N-(4-methylsulfinylbutan-2-yl)-1-thiophen-2-ylpropan-1-amine.
| Compound Name | 2-methyl-N-(4-methylsulfinylbutan-2-yl)-1-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 113348811 |
| Molecular Formula | C13H23NOS2 |
| Molecular Weight | 273.47 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-methyl-N-(4-methylsulfinylbutan-2-yl)-1-thiophen-2-ylpropan-1-amine |
| SMILES | CC(CCS(C)=O)NC(c1cccs1)C(C)C |
| InChI | InChI=1S/C13H23NOS2/c1-10(2)13(12-6-5-8-16-12)14-11(3)7-9-17(4)15/h5-6,8,10-11,13-14H,7,9H2,1-4H3 |
| InChIKey | WVINYJOUFHBJPD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |