C12H21NOS2 — CID 115893295
4-methylsulfinyl-N-(1-thiophen-2-ylpropan-2-yl)butan-2-amine (PubChem CID 115893295) has the molecular formula C12H21NOS2 and a molecular weight of 259.44 g/mol. Its IUPAC name is 4-methylsulfinyl-N-(1-thiophen-2-ylpropan-2-yl)butan-2-amine.
| Compound Name | 4-methylsulfinyl-N-(1-thiophen-2-ylpropan-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 115893295 |
| Molecular Formula | C12H21NOS2 |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 4-methylsulfinyl-N-(1-thiophen-2-ylpropan-2-yl)butan-2-amine |
| SMILES | CC(CCS(C)=O)NC(C)Cc1cccs1 |
| InChI | InChI=1S/C12H21NOS2/c1-10(6-8-16(3)14)13-11(2)9-12-5-4-7-15-12/h4-5,7,10-11,13H,6,8-9H2,1-3H3 |
| InChIKey | ZWDQBJHRSPXFRN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |