C11H23N3O3 — CID 113349364
4-[(3-hydroxy-4-methoxybutyl)amino]piperidine-1-carboxamide (PubChem CID 113349364) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-[(3-hydroxy-4-methoxybutyl)amino]piperidine-1-carboxamide.
| Compound Name | 4-[(3-hydroxy-4-methoxybutyl)amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 113349364 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | 4-[(3-hydroxy-4-methoxybutyl)amino]piperidine-1-carboxamide |
| SMILES | COCC(O)CCNC1CCN(C(N)=O)CC1 |
| InChI | InChI=1S/C11H23N3O3/c1-17-8-10(15)2-5-13-9-3-6-14(7-4-9)11(12)16/h9-10,13,15H,2-8H2,1H3,(H2,12,16) |
| InChIKey | UBYDLQGZWNZYJJ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |