C12H18O4S2 — CID 11335267
3-(3-methylsulfanylpropanoyl)-5-(2-methylsulfanylpropyl)oxolane-2,4-dione (PubChem CID 11335267) has the molecular formula C12H18O4S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-(3-methylsulfanylpropanoyl)-5-(2-methylsulfanylpropyl)oxolane-2,4-dione.
| Compound Name | 3-(3-methylsulfanylpropanoyl)-5-(2-methylsulfanylpropyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 11335267 |
| Molecular Formula | C12H18O4S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3-(3-methylsulfanylpropanoyl)-5-(2-methylsulfanylpropyl)oxolane-2,4-dione |
| SMILES | CSCCC(=O)C1C(=O)OC(CC(C)SC)C1=O |
| InChI | InChI=1S/C12H18O4S2/c1-7(18-3)6-9-11(14)10(12(15)16-9)8(13)4-5-17-2/h7,9-10H,4-6H2,1-3H3 |
| InChIKey | ZXMKOZRAUZGSJY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|