C19H30O4S — CID 11772630
3-(4-tert-butylcyclohexanecarbonyl)-5-(2-methylsulfanylpropyl)oxolane-2,4-dione (PubChem CID 11772630) has the molecular formula C19H30O4S and a molecular weight of 354.51 g/mol. Its IUPAC name is 3-(4-tert-butylcyclohexanecarbonyl)-5-(2-methylsulfanylpropyl)oxolane-2,4-dione.
| Compound Name | 3-(4-tert-butylcyclohexanecarbonyl)-5-(2-methylsulfanylpropyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 11772630 |
| Molecular Formula | C19H30O4S |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 3-(4-tert-butylcyclohexanecarbonyl)-5-(2-methylsulfanylpropyl)oxolane-2,4-dione |
| SMILES | CSC(C)CC1OC(=O)C(C(=O)C2CCC(C(C)(C)C)CC2)C1=O |
| InChI | InChI=1S/C19H30O4S/c1-11(24-5)10-14-17(21)15(18(22)23-14)16(20)12-6-8-13(9-7-12)19(2,3)4/h11-15H,6-10H2,1-5H3 |
| InChIKey | GONXIEZCMKDZIJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|